About (4Z)-4,8-dimethylcyclooct-4-ene-1,2-diol
(4Z)-4,8-dimethylcyclooct-4-ene-1,2-diol (PubChem CID 23092826) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is (4Z)-4,8-dimethylcyclooct-4-ene-1,2-diol.
Molecular Properties
| Compound Name | (4Z)-4,8-dimethylcyclooct-4-ene-1,2-diol |
| PubChem CID | 23092826 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (4Z)-4,8-dimethylcyclooct-4-ene-1,2-diol |
| SMILES | C/C1=C/CCC(C)C(O)C(O)C1 |
| InChI | InChI=1S/C10H18O2/c1-7-4-3-5-8(2)10(12)9(11)6-7/h4,8-12H,3,5-6H2,1-2H3/b7-4- |
| InChIKey | TXLIRQKVUGWBQU-DAXSKMNVSA-N |
| XLogP | 1.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4,8-dimethylcyclooct-4-ene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4,8-dimethylcyclooct-4-ene-1,2-diol?
The IUPAC name of (4Z)-4,8-dimethylcyclooct-4-ene-1,2-diol (CID 23092826) is (4Z)-4,8-dimethylcyclooct-4-ene-1,2-diol.
What is the SMILES notation for (4Z)-4,8-dimethylcyclooct-4-ene-1,2-diol?
The canonical SMILES for (4Z)-4,8-dimethylcyclooct-4-ene-1,2-diol is C/C1=C/CCC(C)C(O)C(O)C1.
What is the InChIKey of (4Z)-4,8-dimethylcyclooct-4-ene-1,2-diol?
The InChIKey is TXLIRQKVUGWBQU-DAXSKMNVSA-N. The full InChI is InChI=1S/C10H18O2/c1-7-4-3-5-8(2)10(12)9(11)6-7/h4,8-12H,3,5-6H2,1-2H3/b7-4-.
What are the key properties of (4Z)-4,8-dimethylcyclooct-4-ene-1,2-diol?
(4Z)-4,8-dimethylcyclooct-4-ene-1,2-diol has a molecular weight of 170.25 g/mol, XLogP of 1.47, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4,8-dimethylcyclooct-4-ene-1,2-diol is sourced from PubChem (CID 23092826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).