About 3-methoxypropyl 2-(methylamino)ethyl carbonate;hydrochloride
3-methoxypropyl 2-(methylamino)ethyl carbonate;hydrochloride (PubChem CID 23093485) has the molecular formula C8H18ClNO4
and a molecular weight of 227.69 g/mol. Its IUPAC name is 3-methoxypropyl 2-(methylamino)ethyl carbonate;hydrochloride.
Molecular Properties
| Compound Name | 3-methoxypropyl 2-(methylamino)ethyl carbonate;hydrochloride |
| PubChem CID | 23093485 |
| Molecular Formula | C8H18ClNO4 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 3-methoxypropyl 2-(methylamino)ethyl carbonate;hydrochloride |
| SMILES | CNCCOC(=O)OCCCOC.Cl |
| InChI | InChI=1S/C8H17NO4.ClH/c1-9-4-7-13-8(10)12-6-3-5-11-2;/h9H,3-7H2,1-2H3;1H |
| InChIKey | JEOKABHDANEWCT-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxypropyl 2-(methylamino)ethyl carbonate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxypropyl 2-(methylamino)ethyl carbonate;hydrochloride?
The IUPAC name of 3-methoxypropyl 2-(methylamino)ethyl carbonate;hydrochloride (CID 23093485) is 3-methoxypropyl 2-(methylamino)ethyl carbonate;hydrochloride.
What is the SMILES notation for 3-methoxypropyl 2-(methylamino)ethyl carbonate;hydrochloride?
The canonical SMILES for 3-methoxypropyl 2-(methylamino)ethyl carbonate;hydrochloride is CNCCOC(=O)OCCCOC.Cl.
What is the InChIKey of 3-methoxypropyl 2-(methylamino)ethyl carbonate;hydrochloride?
The InChIKey is JEOKABHDANEWCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO4.ClH/c1-9-4-7-13-8(10)12-6-3-5-11-2;/h9H,3-7H2,1-2H3;1H.
What are the key properties of 3-methoxypropyl 2-(methylamino)ethyl carbonate;hydrochloride?
3-methoxypropyl 2-(methylamino)ethyl carbonate;hydrochloride has a molecular weight of 227.69 g/mol, XLogP of 0.82, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxypropyl 2-(methylamino)ethyl carbonate;hydrochloride is sourced from PubChem (CID 23093485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).