C23H28N2O3S — CID 2309360
N,N-diethyl-3-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)acetyl]benzenesulfonamide (PubChem CID 2309360) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is N,N-diethyl-3-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)acetyl]benzenesulfonamide.
| Compound Name | N,N-diethyl-3-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)acetyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2309360 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | N,N-diethyl-3-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)acetyl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)/C=C2/N(C)c3ccccc3C2(C)C)c1 |
| InChI | InChI=1S/C23H28N2O3S/c1-6-25(7-2)29(27,28)18-12-10-11-17(15-18)21(26)16-22-23(3,4)19-13-8-9-14-20(19)24(22)5/h8-16H,6-7H2,1-5H3/b22-16+ |
| InChIKey | KCIHGOYYVGCCKT-CJLVFECKSA-N |
| XLogP | 4.21 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|