C18H15ClN2OS2 — CID 23093841
N-(3-chloro-4-methylphenyl)-3-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide (PubChem CID 23093841) has the molecular formula C18H15ClN2OS2 and a molecular weight of 374.92 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-3-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-3-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 23093841 |
| Molecular Formula | C18H15ClN2OS2 |
| Molecular Weight | 374.92 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-3-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2sccc2SCc2ccncc2)cc1Cl |
| InChI | InChI=1S/C18H15ClN2OS2/c1-12-2-3-14(10-15(12)19)21-18(22)17-16(6-9-23-17)24-11-13-4-7-20-8-5-13/h2-10H,11H2,1H3,(H,21,22) |
| InChIKey | MBOHKAUZNQYJOD-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.92 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |