About ethyl (2E)-2-(1,3,3-trimethylindol-2-ylidene)acetate
ethyl (2E)-2-(1,3,3-trimethylindol-2-ylidene)acetate (PubChem CID 2309433) has the molecular formula C15H19NO2
and a molecular weight of 245.32 g/mol. Its IUPAC name is ethyl (2E)-2-(1,3,3-trimethylindol-2-ylidene)acetate.
Molecular Properties
| Compound Name | ethyl (2E)-2-(1,3,3-trimethylindol-2-ylidene)acetate |
| PubChem CID | 2309433 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | ethyl (2E)-2-(1,3,3-trimethylindol-2-ylidene)acetate |
| SMILES | CCOC(=O)/C=C1/N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C15H19NO2/c1-5-18-14(17)10-13-15(2,3)11-8-6-7-9-12(11)16(13)4/h6-10H,5H2,1-4H3/b13-10+ |
| InChIKey | QVDQLOOAPLLJQR-JLHYYAGUSA-N |
| XLogP | 2.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2E)-2-(1,3,3-trimethylindol-2-ylidene)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2E)-2-(1,3,3-trimethylindol-2-ylidene)acetate?
The IUPAC name of ethyl (2E)-2-(1,3,3-trimethylindol-2-ylidene)acetate (CID 2309433) is ethyl (2E)-2-(1,3,3-trimethylindol-2-ylidene)acetate.
What is the SMILES notation for ethyl (2E)-2-(1,3,3-trimethylindol-2-ylidene)acetate?
The canonical SMILES for ethyl (2E)-2-(1,3,3-trimethylindol-2-ylidene)acetate is CCOC(=O)/C=C1/N(C)c2ccccc2C1(C)C.
What is the InChIKey of ethyl (2E)-2-(1,3,3-trimethylindol-2-ylidene)acetate?
The InChIKey is QVDQLOOAPLLJQR-JLHYYAGUSA-N. The full InChI is InChI=1S/C15H19NO2/c1-5-18-14(17)10-13-15(2,3)11-8-6-7-9-12(11)16(13)4/h6-10H,5H2,1-4H3/b13-10+.
What are the key properties of ethyl (2E)-2-(1,3,3-trimethylindol-2-ylidene)acetate?
ethyl (2E)-2-(1,3,3-trimethylindol-2-ylidene)acetate has a molecular weight of 245.32 g/mol, XLogP of 2.86, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2E)-2-(1,3,3-trimethylindol-2-ylidene)acetate is sourced from PubChem (CID 2309433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).