About 3-bromo-N-(2-iodo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide
3-bromo-N-(2-iodo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide (PubChem CID 2309482) has the molecular formula C20H13BrIN3O
and a molecular weight of 518.15 g/mol. Its IUPAC name is 3-bromo-N-(2-iodo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide.
Molecular Properties
| Compound Name | 3-bromo-N-(2-iodo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide |
| PubChem CID | 2309482 |
| Molecular Formula | C20H13BrIN3O |
| Molecular Weight | 518.15 g/mol |
| Exact Mass | 516.93 |
| IUPAC Name | 3-bromo-N-(2-iodo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide |
| SMILES | O=C(/N=C1\N=C2C=CC(I)=CN2Cc2ccccc21)c1cccc(Br)c1 |
| InChI | InChI=1S/C20H13BrIN3O/c21-15-6-3-5-13(10-15)20(26)24-19-17-7-2-1-4-14(17)11-25-12-16(22)8-9-18(25)23-19/h1-10,12H,11H2/b24-19- |
| InChIKey | VRNZMAAVCXTGDU-CLCOLTQESA-N |
| XLogP | 5.10 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 518.15 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-N-(2-iodo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-(2-iodo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide?
The IUPAC name of 3-bromo-N-(2-iodo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide (CID 2309482) is 3-bromo-N-(2-iodo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide.
What is the SMILES notation for 3-bromo-N-(2-iodo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide?
The canonical SMILES for 3-bromo-N-(2-iodo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide is O=C(/N=C1\N=C2C=CC(I)=CN2Cc2ccccc21)c1cccc(Br)c1.
What is the InChIKey of 3-bromo-N-(2-iodo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide?
The InChIKey is VRNZMAAVCXTGDU-CLCOLTQESA-N. The full InChI is InChI=1S/C20H13BrIN3O/c21-15-6-3-5-13(10-15)20(26)24-19-17-7-2-1-4-14(17)11-25-12-16(22)8-9-18(25)23-19/h1-10,12H,11H2/b24-19-.
What are the key properties of 3-bromo-N-(2-iodo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide?
3-bromo-N-(2-iodo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide has a molecular weight of 518.15 g/mol, XLogP of 5.10, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-(2-iodo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide is sourced from PubChem (CID 2309482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).