C22H18Cl2N2O3S — CID 23095520
N-[4-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanylphenyl]-3-methoxybenzamide (PubChem CID 23095520) has the molecular formula C22H18Cl2N2O3S and a molecular weight of 461.37 g/mol. Its IUPAC name is N-[4-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanylphenyl]-3-methoxybenzamide.
| Compound Name | N-[4-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanylphenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 23095520 |
| Molecular Formula | C22H18Cl2N2O3S |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | N-[4-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanylphenyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(SCC(=O)Nc3ccc(Cl)c(Cl)c3)cc2)c1 |
| InChI | InChI=1S/C22H18Cl2N2O3S/c1-29-17-4-2-3-14(11-17)22(28)26-15-5-8-18(9-6-15)30-13-21(27)25-16-7-10-19(23)20(24)12-16/h2-12H,13H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | CKZZTFXQLUGQBQ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |