C20H15ClN2O5S2 — CID 2309674
(5Z)-5-[(2-chlorophenyl)methylidene]-3-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 2309674) has the molecular formula C20H15ClN2O5S2 and a molecular weight of 462.94 g/mol. Its IUPAC name is (5Z)-5-[(2-chlorophenyl)methylidene]-3-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(2-chlorophenyl)methylidene]-3-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2309674 |
| Molecular Formula | C20H15ClN2O5S2 |
| Molecular Weight | 462.94 g/mol |
| Exact Mass | 462.01 |
| IUPAC Name | (5Z)-5-[(2-chlorophenyl)methylidene]-3-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCS(=O)(=O)c1ccc2oc(CN3C(=O)S/C(=C\c4ccccc4Cl)C3=O)nc2c1 |
| InChI | InChI=1S/C20H15ClN2O5S2/c1-2-30(26,27)13-7-8-16-15(10-13)22-18(28-16)11-23-19(24)17(29-20(23)25)9-12-5-3-4-6-14(12)21/h3-10H,2,11H2,1H3/b17-9- |
| InChIKey | OGKGJUTVALXYEV-MFOYZWKCSA-N |
| XLogP | 4.51 |
| TPSA | 97.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.94 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|