C21H26N2O3 — CID 2309754
2-tert-butyl-5-[4-(2-methoxyphenyl)piperazin-1-yl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 2309754) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-tert-butyl-5-[4-(2-methoxyphenyl)piperazin-1-yl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-tert-butyl-5-[4-(2-methoxyphenyl)piperazin-1-yl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 2309754 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 2-tert-butyl-5-[4-(2-methoxyphenyl)piperazin-1-yl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | COc1ccccc1N1CCN(C2=CC(=O)C(C(C)(C)C)=CC2=O)CC1 |
| InChI | InChI=1S/C21H26N2O3/c1-21(2,3)15-13-19(25)17(14-18(15)24)23-11-9-22(10-12-23)16-7-5-6-8-20(16)26-4/h5-8,13-14H,9-12H2,1-4H3 |
| InChIKey | IASOKJWXECHXAN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|