C13H18N2O — CID 2309930
N-(3-methoxyphenyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine (PubChem CID 2309930) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine.
| Compound Name | N-(3-methoxyphenyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine |
|---|---|
| PubChem CID | 2309930 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | N-(3-methoxyphenyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine |
| SMILES | COc1cccc(NC2=NCCCCC2)c1 |
| InChI | InChI=1S/C13H18N2O/c1-16-12-7-5-6-11(10-12)15-13-8-3-2-4-9-14-13/h5-7,10H,2-4,8-9H2,1H3,(H,14,15) |
| InChIKey | ASLXWGDYFXXKLG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |