About [5-(2,3-dichlorophenyl)furan-2-yl]methyl 2-chloro-5-iodobenzoate
[5-(2,3-dichlorophenyl)furan-2-yl]methyl 2-chloro-5-iodobenzoate (PubChem CID 23100763) has the molecular formula C18H10Cl3IO3
and a molecular weight of 507.54 g/mol. Its IUPAC name is [5-(2,3-dichlorophenyl)furan-2-yl]methyl 2-chloro-5-iodobenzoate.
Molecular Properties
| Compound Name | [5-(2,3-dichlorophenyl)furan-2-yl]methyl 2-chloro-5-iodobenzoate |
| PubChem CID | 23100763 |
| Molecular Formula | C18H10Cl3IO3 |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 505.87 |
| IUPAC Name | [5-(2,3-dichlorophenyl)furan-2-yl]methyl 2-chloro-5-iodobenzoate |
| SMILES | O=C(OCc1ccc(-c2cccc(Cl)c2Cl)o1)c1cc(I)ccc1Cl |
| InChI | InChI=1S/C18H10Cl3IO3/c19-14-6-4-10(22)8-13(14)18(23)24-9-11-5-7-16(25-11)12-2-1-3-15(20)17(12)21/h1-8H,9H2 |
| InChIKey | GIIADHBHVUZASL-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [5-(2,3-dichlorophenyl)furan-2-yl]methyl 2-chloro-5-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2,3-dichlorophenyl)furan-2-yl]methyl 2-chloro-5-iodobenzoate?
The IUPAC name of [5-(2,3-dichlorophenyl)furan-2-yl]methyl 2-chloro-5-iodobenzoate (CID 23100763) is [5-(2,3-dichlorophenyl)furan-2-yl]methyl 2-chloro-5-iodobenzoate.
What is the SMILES notation for [5-(2,3-dichlorophenyl)furan-2-yl]methyl 2-chloro-5-iodobenzoate?
The canonical SMILES for [5-(2,3-dichlorophenyl)furan-2-yl]methyl 2-chloro-5-iodobenzoate is O=C(OCc1ccc(-c2cccc(Cl)c2Cl)o1)c1cc(I)ccc1Cl.
What is the InChIKey of [5-(2,3-dichlorophenyl)furan-2-yl]methyl 2-chloro-5-iodobenzoate?
The InChIKey is GIIADHBHVUZASL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10Cl3IO3/c19-14-6-4-10(22)8-13(14)18(23)24-9-11-5-7-16(25-11)12-2-1-3-15(20)17(12)21/h1-8H,9H2.
What are the key properties of [5-(2,3-dichlorophenyl)furan-2-yl]methyl 2-chloro-5-iodobenzoate?
[5-(2,3-dichlorophenyl)furan-2-yl]methyl 2-chloro-5-iodobenzoate has a molecular weight of 507.54 g/mol, XLogP of 6.87, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2,3-dichlorophenyl)furan-2-yl]methyl 2-chloro-5-iodobenzoate is sourced from PubChem (CID 23100763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).