C19H19ClN4O2S2 — CID 23101987
[2-[(6-chloro-2-pyridinyl)amino]-2-oxoethyl] 6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate (PubChem CID 23101987) has the molecular formula C19H19ClN4O2S2 and a molecular weight of 434.97 g/mol. Its IUPAC name is [2-[(6-chloro-2-pyridinyl)amino]-2-oxoethyl] 6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate.
| Compound Name | [2-[(6-chloro-2-pyridinyl)amino]-2-oxoethyl] 6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate |
|---|---|
| PubChem CID | 23101987 |
| Molecular Formula | C19H19ClN4O2S2 |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | [2-[(6-chloro-2-pyridinyl)amino]-2-oxoethyl] 6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate |
| SMILES | O=C(CSC(=S)N1CC2CC(C1)c1cccc(=O)n1C2)Nc1cccc(Cl)n1 |
| InChI | InChI=1S/C19H19ClN4O2S2/c20-15-4-2-5-16(21-15)22-17(25)11-28-19(27)23-8-12-7-13(10-23)14-3-1-6-18(26)24(14)9-12/h1-6,12-13H,7-11H2,(H,21,22,25) |
| InChIKey | NHNSVEGLUJJAHX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|