About [2-(4-methylphenyl)-2-oxoethyl] 2-(1H-indol-4-yl)-1,3-thiazolidine-4-carboxylate
[2-(4-methylphenyl)-2-oxoethyl] 2-(1H-indol-4-yl)-1,3-thiazolidine-4-carboxylate (PubChem CID 23102097) has the molecular formula C21H20N2O3S
and a molecular weight of 380.47 g/mol. Its IUPAC name is [2-(4-methylphenyl)-2-oxoethyl] 2-(1H-indol-4-yl)-1,3-thiazolidine-4-carboxylate.
Molecular Properties
| Compound Name | [2-(4-methylphenyl)-2-oxoethyl] 2-(1H-indol-4-yl)-1,3-thiazolidine-4-carboxylate |
| PubChem CID | 23102097 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | [2-(4-methylphenyl)-2-oxoethyl] 2-(1H-indol-4-yl)-1,3-thiazolidine-4-carboxylate |
| SMILES | Cc1ccc(C(=O)COC(=O)C2CSC(c3cccc4[nH]ccc34)N2)cc1 |
| InChI | InChI=1S/C21H20N2O3S/c1-13-5-7-14(8-6-13)19(24)11-26-21(25)18-12-27-20(23-18)16-3-2-4-17-15(16)9-10-22-17/h2-10,18,20,22-23H,11-12H2,1H3 |
| InChIKey | GUKJKVSZPXALBX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(4-methylphenyl)-2-oxoethyl] 2-(1H-indol-4-yl)-1,3-thiazolidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-methylphenyl)-2-oxoethyl] 2-(1H-indol-4-yl)-1,3-thiazolidine-4-carboxylate?
The IUPAC name of [2-(4-methylphenyl)-2-oxoethyl] 2-(1H-indol-4-yl)-1,3-thiazolidine-4-carboxylate (CID 23102097) is [2-(4-methylphenyl)-2-oxoethyl] 2-(1H-indol-4-yl)-1,3-thiazolidine-4-carboxylate.
What is the SMILES notation for [2-(4-methylphenyl)-2-oxoethyl] 2-(1H-indol-4-yl)-1,3-thiazolidine-4-carboxylate?
The canonical SMILES for [2-(4-methylphenyl)-2-oxoethyl] 2-(1H-indol-4-yl)-1,3-thiazolidine-4-carboxylate is Cc1ccc(C(=O)COC(=O)C2CSC(c3cccc4[nH]ccc34)N2)cc1.
What is the InChIKey of [2-(4-methylphenyl)-2-oxoethyl] 2-(1H-indol-4-yl)-1,3-thiazolidine-4-carboxylate?
The InChIKey is GUKJKVSZPXALBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O3S/c1-13-5-7-14(8-6-13)19(24)11-26-21(25)18-12-27-20(23-18)16-3-2-4-17-15(16)9-10-22-17/h2-10,18,20,22-23H,11-12H2,1H3.
What are the key properties of [2-(4-methylphenyl)-2-oxoethyl] 2-(1H-indol-4-yl)-1,3-thiazolidine-4-carboxylate?
[2-(4-methylphenyl)-2-oxoethyl] 2-(1H-indol-4-yl)-1,3-thiazolidine-4-carboxylate has a molecular weight of 380.47 g/mol, XLogP of 3.61, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-methylphenyl)-2-oxoethyl] 2-(1H-indol-4-yl)-1,3-thiazolidine-4-carboxylate is sourced from PubChem (CID 23102097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).