C22H14F6N2O6S — CID 2310223
[2-[4-(benzenesulfonamido)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] 4-nitrobenzoate (PubChem CID 2310223) has the molecular formula C22H14F6N2O6S and a molecular weight of 548.42 g/mol. Its IUPAC name is [2-[4-(benzenesulfonamido)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] 4-nitrobenzoate.
| Compound Name | [2-[4-(benzenesulfonamido)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 2310223 |
| Molecular Formula | C22H14F6N2O6S |
| Molecular Weight | 548.42 g/mol |
| Exact Mass | 548.05 |
| IUPAC Name | [2-[4-(benzenesulfonamido)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] 4-nitrobenzoate |
| SMILES | O=C(OC(c1ccc(NS(=O)(=O)c2ccccc2)cc1)(C(F)(F)F)C(F)(F)F)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H14F6N2O6S/c23-21(24,25)20(22(26,27)28,36-19(31)14-6-12-17(13-7-14)30(32)33)15-8-10-16(11-9-15)29-37(34,35)18-4-2-1-3-5-18/h1-13,29H |
| InChIKey | ZQYJJPJRNKKVHO-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.42 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|