C20H22Cl2F3NO6S — CID 23102887
tert-butyl 6,7-dichloro-2-(2,2-dimethylpropyl)-1-oxo-4-(trifluoromethylsulfonyloxy)isoquinoline-3-carboxylate (PubChem CID 23102887) has the molecular formula C20H22Cl2F3NO6S and a molecular weight of 532.36 g/mol. Its IUPAC name is tert-butyl 6,7-dichloro-2-(2,2-dimethylpropyl)-1-oxo-4-(trifluoromethylsulfonyloxy)isoquinoline-3-carboxylate.
| Compound Name | tert-butyl 6,7-dichloro-2-(2,2-dimethylpropyl)-1-oxo-4-(trifluoromethylsulfonyloxy)isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 23102887 |
| Molecular Formula | C20H22Cl2F3NO6S |
| Molecular Weight | 532.36 g/mol |
| Exact Mass | 531.05 |
| IUPAC Name | tert-butyl 6,7-dichloro-2-(2,2-dimethylpropyl)-1-oxo-4-(trifluoromethylsulfonyloxy)isoquinoline-3-carboxylate |
| SMILES | CC(C)(C)Cn1c(C(=O)OC(C)(C)C)c(OS(=O)(=O)C(F)(F)F)c2cc(Cl)c(Cl)cc2c1=O |
| InChI | InChI=1S/C20H22Cl2F3NO6S/c1-18(2,3)9-26-14(17(28)31-19(4,5)6)15(32-33(29,30)20(23,24)25)10-7-12(21)13(22)8-11(10)16(26)27/h7-8H,9H2,1-6H3 |
| InChIKey | IFZZGTHPWONBBH-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.36 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|