About 2-methoxyethyl 2-(methylamino)ethyl carbonate;hydrochloride
2-methoxyethyl 2-(methylamino)ethyl carbonate;hydrochloride (PubChem CID 23103056) has the molecular formula C7H16ClNO4
and a molecular weight of 213.66 g/mol. Its IUPAC name is 2-methoxyethyl 2-(methylamino)ethyl carbonate;hydrochloride.
Molecular Properties
| Compound Name | 2-methoxyethyl 2-(methylamino)ethyl carbonate;hydrochloride |
| PubChem CID | 23103056 |
| Molecular Formula | C7H16ClNO4 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 2-methoxyethyl 2-(methylamino)ethyl carbonate;hydrochloride |
| SMILES | CNCCOC(=O)OCCOC.Cl |
| InChI | InChI=1S/C7H15NO4.ClH/c1-8-3-4-11-7(9)12-6-5-10-2;/h8H,3-6H2,1-2H3;1H |
| InChIKey | PZPYRIKMDBMQSO-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethyl 2-(methylamino)ethyl carbonate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethyl 2-(methylamino)ethyl carbonate;hydrochloride?
The IUPAC name of 2-methoxyethyl 2-(methylamino)ethyl carbonate;hydrochloride (CID 23103056) is 2-methoxyethyl 2-(methylamino)ethyl carbonate;hydrochloride.
What is the SMILES notation for 2-methoxyethyl 2-(methylamino)ethyl carbonate;hydrochloride?
The canonical SMILES for 2-methoxyethyl 2-(methylamino)ethyl carbonate;hydrochloride is CNCCOC(=O)OCCOC.Cl.
What is the InChIKey of 2-methoxyethyl 2-(methylamino)ethyl carbonate;hydrochloride?
The InChIKey is PZPYRIKMDBMQSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO4.ClH/c1-8-3-4-11-7(9)12-6-5-10-2;/h8H,3-6H2,1-2H3;1H.
What are the key properties of 2-methoxyethyl 2-(methylamino)ethyl carbonate;hydrochloride?
2-methoxyethyl 2-(methylamino)ethyl carbonate;hydrochloride has a molecular weight of 213.66 g/mol, XLogP of 0.43, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl 2-(methylamino)ethyl carbonate;hydrochloride is sourced from PubChem (CID 23103056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).