C18H34N2S5 — CID 23103669
4,5-bis(2,4,4-trimethylpentan-2-yldisulfanyl)thiadiazole (PubChem CID 23103669) has the molecular formula C18H34N2S5 and a molecular weight of 438.82 g/mol. Its IUPAC name is 4,5-bis(2,4,4-trimethylpentan-2-yldisulfanyl)thiadiazole.
| Compound Name | 4,5-bis(2,4,4-trimethylpentan-2-yldisulfanyl)thiadiazole |
|---|---|
| PubChem CID | 23103669 |
| Molecular Formula | C18H34N2S5 |
| Molecular Weight | 438.82 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 4,5-bis(2,4,4-trimethylpentan-2-yldisulfanyl)thiadiazole |
| SMILES | CC(C)(C)CC(C)(C)SSc1nnsc1SSC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C18H34N2S5/c1-15(2,3)11-17(7,8)24-22-13-14(21-20-19-13)23-25-18(9,10)12-16(4,5)6/h11-12H2,1-10H3 |
| InChIKey | ZNRQCVCZJDZJPE-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.82 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|