About 1,2-didecylguanidine
1,2-didecylguanidine (PubChem CID 23103964) has the molecular formula C21H45N3
and a molecular weight of 339.61 g/mol. Its IUPAC name is 1,2-didecylguanidine.
Molecular Properties
| Compound Name | 1,2-didecylguanidine |
| PubChem CID | 23103964 |
| Molecular Formula | C21H45N3 |
| Molecular Weight | 339.61 g/mol |
| Exact Mass | 339.36 |
| IUPAC Name | 1,2-didecylguanidine |
| SMILES | CCCCCCCCCC/N=C(\N)NCCCCCCCCCC |
| InChI | InChI=1S/C21H45N3/c1-3-5-7-9-11-13-15-17-19-23-21(22)24-20-18-16-14-12-10-8-6-4-2/h3-20H2,1-2H3,(H3,22,23,24) |
| InChIKey | QGLXFWFUPYCBAF-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.61 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1,2-didecylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-didecylguanidine?
The IUPAC name of 1,2-didecylguanidine (CID 23103964) is 1,2-didecylguanidine.
What is the SMILES notation for 1,2-didecylguanidine?
The canonical SMILES for 1,2-didecylguanidine is CCCCCCCCCC/N=C(\N)NCCCCCCCCCC.
What is the InChIKey of 1,2-didecylguanidine?
The InChIKey is QGLXFWFUPYCBAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H45N3/c1-3-5-7-9-11-13-15-17-19-23-21(22)24-20-18-16-14-12-10-8-6-4-2/h3-20H2,1-2H3,(H3,22,23,24).
What are the key properties of 1,2-didecylguanidine?
1,2-didecylguanidine has a molecular weight of 339.61 g/mol, XLogP of 6.17, 18 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-didecylguanidine is sourced from PubChem (CID 23103964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).