C16H35N3 — CID 23103984
1,1,2-tris(2,2-dimethylpropyl)guanidine (PubChem CID 23103984) has the molecular formula C16H35N3 and a molecular weight of 269.48 g/mol. Its IUPAC name is 1,1,2-tris(2,2-dimethylpropyl)guanidine.
| Compound Name | 1,1,2-tris(2,2-dimethylpropyl)guanidine |
|---|---|
| PubChem CID | 23103984 |
| Molecular Formula | C16H35N3 |
| Molecular Weight | 269.48 g/mol |
| Exact Mass | 269.28 |
| IUPAC Name | 1,1,2-tris(2,2-dimethylpropyl)guanidine |
| SMILES | CC(C)(C)C/N=C(\N)N(CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C16H35N3/c1-14(2,3)10-18-13(17)19(11-15(4,5)6)12-16(7,8)9/h10-12H2,1-9H3,(H2,17,18) |
| InChIKey | XDGYOCJKKUUFJA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|