C15H33N3O2 — CID 23104027
1,2-bis(3-butoxypropyl)guanidine (PubChem CID 23104027) has the molecular formula C15H33N3O2 and a molecular weight of 287.45 g/mol. Its IUPAC name is 1,2-bis(3-butoxypropyl)guanidine.
| Compound Name | 1,2-bis(3-butoxypropyl)guanidine |
|---|---|
| PubChem CID | 23104027 |
| Molecular Formula | C15H33N3O2 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | 1,2-bis(3-butoxypropyl)guanidine |
| SMILES | CCCCOCCC/N=C(\N)NCCCOCCCC |
| InChI | InChI=1S/C15H33N3O2/c1-3-5-11-19-13-7-9-17-15(16)18-10-8-14-20-12-6-4-2/h3-14H2,1-2H3,(H3,16,17,18) |
| InChIKey | VXQCREMRVZARJE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|