About 4-amino-1,2-diethyl-5-(ethylamino)pyrazol-3-one
4-amino-1,2-diethyl-5-(ethylamino)pyrazol-3-one (PubChem CID 23104215) has the molecular formula C9H18N4O
and a molecular weight of 198.27 g/mol. Its IUPAC name is 4-amino-1,2-diethyl-5-(ethylamino)pyrazol-3-one.
Molecular Properties
| Compound Name | 4-amino-1,2-diethyl-5-(ethylamino)pyrazol-3-one |
| PubChem CID | 23104215 |
| Molecular Formula | C9H18N4O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | 4-amino-1,2-diethyl-5-(ethylamino)pyrazol-3-one |
| SMILES | CCNc1c(N)c(=O)n(CC)n1CC |
| InChI | InChI=1S/C9H18N4O/c1-4-11-8-7(10)9(14)13(6-3)12(8)5-2/h11H,4-6,10H2,1-3H3 |
| InChIKey | UEENFUOPPVEIBV-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 64.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-1,2-diethyl-5-(ethylamino)pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1,2-diethyl-5-(ethylamino)pyrazol-3-one?
The IUPAC name of 4-amino-1,2-diethyl-5-(ethylamino)pyrazol-3-one (CID 23104215) is 4-amino-1,2-diethyl-5-(ethylamino)pyrazol-3-one.
What is the SMILES notation for 4-amino-1,2-diethyl-5-(ethylamino)pyrazol-3-one?
The canonical SMILES for 4-amino-1,2-diethyl-5-(ethylamino)pyrazol-3-one is CCNc1c(N)c(=O)n(CC)n1CC.
What is the InChIKey of 4-amino-1,2-diethyl-5-(ethylamino)pyrazol-3-one?
The InChIKey is UEENFUOPPVEIBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4O/c1-4-11-8-7(10)9(14)13(6-3)12(8)5-2/h11H,4-6,10H2,1-3H3.
What are the key properties of 4-amino-1,2-diethyl-5-(ethylamino)pyrazol-3-one?
4-amino-1,2-diethyl-5-(ethylamino)pyrazol-3-one has a molecular weight of 198.27 g/mol, XLogP of 0.70, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1,2-diethyl-5-(ethylamino)pyrazol-3-one is sourced from PubChem (CID 23104215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).