About 4-amino-1,2-diethyl-5-(4-methylpiperazin-1-yl)pyrazolidin-3-one
4-amino-1,2-diethyl-5-(4-methylpiperazin-1-yl)pyrazolidin-3-one (PubChem CID 23104221) has the molecular formula C12H25N5O
and a molecular weight of 255.37 g/mol. Its IUPAC name is 4-amino-1,2-diethyl-5-(4-methylpiperazin-1-yl)pyrazolidin-3-one.
Molecular Properties
| Compound Name | 4-amino-1,2-diethyl-5-(4-methylpiperazin-1-yl)pyrazolidin-3-one |
| PubChem CID | 23104221 |
| Molecular Formula | C12H25N5O |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.21 |
| IUPAC Name | 4-amino-1,2-diethyl-5-(4-methylpiperazin-1-yl)pyrazolidin-3-one |
| SMILES | CCN1C(=O)C(N)C(N2CCN(C)CC2)N1CC |
| InChI | InChI=1S/C12H25N5O/c1-4-16-11(10(13)12(18)17(16)5-2)15-8-6-14(3)7-9-15/h10-11H,4-9,13H2,1-3H3 |
| InChIKey | VJVGBXMOOUZNHR-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-1,2-diethyl-5-(4-methylpiperazin-1-yl)pyrazolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1,2-diethyl-5-(4-methylpiperazin-1-yl)pyrazolidin-3-one?
The IUPAC name of 4-amino-1,2-diethyl-5-(4-methylpiperazin-1-yl)pyrazolidin-3-one (CID 23104221) is 4-amino-1,2-diethyl-5-(4-methylpiperazin-1-yl)pyrazolidin-3-one.
What is the SMILES notation for 4-amino-1,2-diethyl-5-(4-methylpiperazin-1-yl)pyrazolidin-3-one?
The canonical SMILES for 4-amino-1,2-diethyl-5-(4-methylpiperazin-1-yl)pyrazolidin-3-one is CCN1C(=O)C(N)C(N2CCN(C)CC2)N1CC.
What is the InChIKey of 4-amino-1,2-diethyl-5-(4-methylpiperazin-1-yl)pyrazolidin-3-one?
The InChIKey is VJVGBXMOOUZNHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N5O/c1-4-16-11(10(13)12(18)17(16)5-2)15-8-6-14(3)7-9-15/h10-11H,4-9,13H2,1-3H3.
What are the key properties of 4-amino-1,2-diethyl-5-(4-methylpiperazin-1-yl)pyrazolidin-3-one?
4-amino-1,2-diethyl-5-(4-methylpiperazin-1-yl)pyrazolidin-3-one has a molecular weight of 255.37 g/mol, XLogP of -1.01, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1,2-diethyl-5-(4-methylpiperazin-1-yl)pyrazolidin-3-one is sourced from PubChem (CID 23104221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).