C8H19NO2 — CID 23105272
2-(2-ethoxyethoxy)-N,N-dimethylethanamine (PubChem CID 23105272) has the molecular formula C8H19NO2 and a molecular weight of 161.25 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)-N,N-dimethylethanamine.
| Compound Name | 2-(2-ethoxyethoxy)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 23105272 |
| Molecular Formula | C8H19NO2 |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.14 |
| IUPAC Name | 2-(2-ethoxyethoxy)-N,N-dimethylethanamine |
| SMILES | CCOCCOCCN(C)C |
| InChI | InChI=1S/C8H19NO2/c1-4-10-7-8-11-6-5-9(2)3/h4-8H2,1-3H3 |
| InChIKey | FVGZDOCAPMQZIC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|