C6H11N3O3S — CID 23105422
1,3,6-triaminocyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 23105422) has the molecular formula C6H11N3O3S and a molecular weight of 205.24 g/mol. Its IUPAC name is 1,3,6-triaminocyclohexa-2,4-diene-1-sulfonic acid.
| Compound Name | 1,3,6-triaminocyclohexa-2,4-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 23105422 |
| Molecular Formula | C6H11N3O3S |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 1,3,6-triaminocyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | NC1=CC(N)(S(=O)(=O)O)C(N)C=C1 |
| InChI | InChI=1S/C6H11N3O3S/c7-4-1-2-5(8)6(9,3-4)13(10,11)12/h1-3,5H,7-9H2,(H,10,11,12) |
| InChIKey | IQGJEPQCVKQEGI-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 132.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|