C21H23NO6S2 — CID 23105655
4-[[ethyl-(6-phenyl-5-sulfocyclohexa-1,5-dien-1-yl)amino]methyl]benzenesulfonic acid (PubChem CID 23105655) has the molecular formula C21H23NO6S2 and a molecular weight of 449.55 g/mol. Its IUPAC name is 4-[[ethyl-(6-phenyl-5-sulfocyclohexa-1,5-dien-1-yl)amino]methyl]benzenesulfonic acid.
| Compound Name | 4-[[ethyl-(6-phenyl-5-sulfocyclohexa-1,5-dien-1-yl)amino]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 23105655 |
| Molecular Formula | C21H23NO6S2 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 4-[[ethyl-(6-phenyl-5-sulfocyclohexa-1,5-dien-1-yl)amino]methyl]benzenesulfonic acid |
| SMILES | CCN(Cc1ccc(S(=O)(=O)O)cc1)C1=CCCC(S(=O)(=O)O)=C1c1ccccc1 |
| InChI | InChI=1S/C21H23NO6S2/c1-2-22(15-16-11-13-18(14-12-16)29(23,24)25)19-9-6-10-20(30(26,27)28)21(19)17-7-4-3-5-8-17/h3-5,7-9,11-14H,2,6,10,15H2,1H3,(H,23,24,25)(H,26,27,28) |
| InChIKey | DTWJQJLUZDDXIZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|