C23H30ClNO2 — CID 23105696
1-(3-chlorophenyl)-2-[(dimethylamino)methyl]-4-[(3-methoxyphenyl)methyl]cyclohexan-1-ol (PubChem CID 23105696) has the molecular formula C23H30ClNO2 and a molecular weight of 387.95 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-[(dimethylamino)methyl]-4-[(3-methoxyphenyl)methyl]cyclohexan-1-ol.
| Compound Name | 1-(3-chlorophenyl)-2-[(dimethylamino)methyl]-4-[(3-methoxyphenyl)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 23105696 |
| Molecular Formula | C23H30ClNO2 |
| Molecular Weight | 387.95 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 1-(3-chlorophenyl)-2-[(dimethylamino)methyl]-4-[(3-methoxyphenyl)methyl]cyclohexan-1-ol |
| SMILES | COc1cccc(CC2CCC(O)(c3cccc(Cl)c3)C(CN(C)C)C2)c1 |
| InChI | InChI=1S/C23H30ClNO2/c1-25(2)16-20-13-18(12-17-6-4-9-22(14-17)27-3)10-11-23(20,26)19-7-5-8-21(24)15-19/h4-9,14-15,18,20,26H,10-13,16H2,1-3H3 |
| InChIKey | OYHGZCPSHWTIMK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.95 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |