1-(2-formyl-1,3-thiazol-4-yl)ethylcarbamic acid

C7H8N2O3S — CID 23106513

IUPAC1-(2-formyl-1,3-thiazol-4-yl)ethylcarbamic acid
SMILESCC(NC(=O)O)c1csc(C=O)n1
InChIInChI=1S/C7H8N2O3S/c1-4(8-7(11)12)5-3-13-6(2-10)9-5/h2-4,8H,1H3,(H,11,12)
InChIKeyRLRUCYVSTZWSSK-UHFFFAOYSA-N
MW200.22 g/mol
LogP1.28
Rot. Bonds3

About 1-(2-formyl-1,3-thiazol-4-yl)ethylcarbamic acid

1-(2-formyl-1,3-thiazol-4-yl)ethylcarbamic acid (PubChem CID 23106513) has the molecular formula C7H8N2O3S and a molecular weight of 200.22 g/mol. Its IUPAC name is 1-(2-formyl-1,3-thiazol-4-yl)ethylcarbamic acid.

Molecular Properties

Compound Name1-(2-formyl-1,3-thiazol-4-yl)ethylcarbamic acid
PubChem CID23106513
Molecular FormulaC7H8N2O3S
Molecular Weight200.22 g/mol
Exact Mass200.03
IUPAC Name1-(2-formyl-1,3-thiazol-4-yl)ethylcarbamic acid
SMILESCC(NC(=O)O)c1csc(C=O)n1
InChIInChI=1S/C7H8N2O3S/c1-4(8-7(11)12)5-3-13-6(2-10)9-5/h2-4,8H,1H3,(H,11,12)
InChIKeyRLRUCYVSTZWSSK-UHFFFAOYSA-N
XLogP1.28
TPSA79.29 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.22
LogP ≤ 51.28
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 1-(2-formyl-1,3-thiazol-4-yl)ethylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2-formyl-1,3-thiazol-4-yl)ethylcarbamic acid?
The IUPAC name of 1-(2-formyl-1,3-thiazol-4-yl)ethylcarbamic acid (CID 23106513) is 1-(2-formyl-1,3-thiazol-4-yl)ethylcarbamic acid.
What is the SMILES notation for 1-(2-formyl-1,3-thiazol-4-yl)ethylcarbamic acid?
The canonical SMILES for 1-(2-formyl-1,3-thiazol-4-yl)ethylcarbamic acid is CC(NC(=O)O)c1csc(C=O)n1.
What is the InChIKey of 1-(2-formyl-1,3-thiazol-4-yl)ethylcarbamic acid?
The InChIKey is RLRUCYVSTZWSSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3S/c1-4(8-7(11)12)5-3-13-6(2-10)9-5/h2-4,8H,1H3,(H,11,12).
What are the key properties of 1-(2-formyl-1,3-thiazol-4-yl)ethylcarbamic acid?
1-(2-formyl-1,3-thiazol-4-yl)ethylcarbamic acid has a molecular weight of 200.22 g/mol, XLogP of 1.28, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-formyl-1,3-thiazol-4-yl)ethylcarbamic acid is sourced from PubChem (CID 23106513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).