About 7,10-dichloro-2-methoxybenzo[b][1,5]naphthyridine
7,10-dichloro-2-methoxybenzo[b][1,5]naphthyridine (PubChem CID 23107) has the molecular formula C13H8Cl2N2O
and a molecular weight of 279.13 g/mol. Its IUPAC name is 7,10-dichloro-2-methoxybenzo[b][1,5]naphthyridine.
Molecular Properties
| Compound Name | 7,10-dichloro-2-methoxybenzo[b][1,5]naphthyridine |
| PubChem CID | 23107 |
| Molecular Formula | C13H8Cl2N2O |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 7,10-dichloro-2-methoxybenzo[b][1,5]naphthyridine |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(Cl)c2n1 |
| InChI | InChI=1S/C13H8Cl2N2O/c1-18-11-5-4-9-13(17-11)12(15)8-3-2-7(14)6-10(8)16-9/h2-6H,1H3 |
| InChIKey | KHPZCNJKNIHKPI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 7,10-dichloro-2-methoxybenzo[b][1,5]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,10-dichloro-2-methoxybenzo[b][1,5]naphthyridine?
The IUPAC name of 7,10-dichloro-2-methoxybenzo[b][1,5]naphthyridine (CID 23107) is 7,10-dichloro-2-methoxybenzo[b][1,5]naphthyridine.
What is the SMILES notation for 7,10-dichloro-2-methoxybenzo[b][1,5]naphthyridine?
The canonical SMILES for 7,10-dichloro-2-methoxybenzo[b][1,5]naphthyridine is COc1ccc2nc3cc(Cl)ccc3c(Cl)c2n1.
What is the InChIKey of 7,10-dichloro-2-methoxybenzo[b][1,5]naphthyridine?
The InChIKey is KHPZCNJKNIHKPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Cl2N2O/c1-18-11-5-4-9-13(17-11)12(15)8-3-2-7(14)6-10(8)16-9/h2-6H,1H3.
What are the key properties of 7,10-dichloro-2-methoxybenzo[b][1,5]naphthyridine?
7,10-dichloro-2-methoxybenzo[b][1,5]naphthyridine has a molecular weight of 279.13 g/mol, XLogP of 4.10, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,10-dichloro-2-methoxybenzo[b][1,5]naphthyridine is sourced from PubChem (CID 23107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).