About 1-(5-methylcyclopenta-1,4-dien-1-yl)adamantane
1-(5-methylcyclopenta-1,4-dien-1-yl)adamantane (PubChem CID 23107142) has the molecular formula C16H22
and a molecular weight of 214.35 g/mol. Its IUPAC name is 1-(5-methylcyclopenta-1,4-dien-1-yl)adamantane.
Molecular Properties
| Compound Name | 1-(5-methylcyclopenta-1,4-dien-1-yl)adamantane |
| PubChem CID | 23107142 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 1-(5-methylcyclopenta-1,4-dien-1-yl)adamantane |
| SMILES | CC1=CCC=C1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H22/c1-11-3-2-4-15(11)16-8-12-5-13(9-16)7-14(6-12)10-16/h3-4,12-14H,2,5-10H2,1H3 |
| InChIKey | FLYVPGKLZOJDIY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(5-methylcyclopenta-1,4-dien-1-yl)adamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-methylcyclopenta-1,4-dien-1-yl)adamantane?
The IUPAC name of 1-(5-methylcyclopenta-1,4-dien-1-yl)adamantane (CID 23107142) is 1-(5-methylcyclopenta-1,4-dien-1-yl)adamantane.
What is the SMILES notation for 1-(5-methylcyclopenta-1,4-dien-1-yl)adamantane?
The canonical SMILES for 1-(5-methylcyclopenta-1,4-dien-1-yl)adamantane is CC1=CCC=C1C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-(5-methylcyclopenta-1,4-dien-1-yl)adamantane?
The InChIKey is FLYVPGKLZOJDIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22/c1-11-3-2-4-15(11)16-8-12-5-13(9-16)7-14(6-12)10-16/h3-4,12-14H,2,5-10H2,1H3.
What are the key properties of 1-(5-methylcyclopenta-1,4-dien-1-yl)adamantane?
1-(5-methylcyclopenta-1,4-dien-1-yl)adamantane has a molecular weight of 214.35 g/mol, XLogP of 4.48, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-methylcyclopenta-1,4-dien-1-yl)adamantane is sourced from PubChem (CID 23107142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).