C21H20ClN4O2P — CID 2310716
3-(4-chlorophenyl)-7-methyl-5-phenyl-1-pyrrolidin-1-ylpyrazolo[4,5-c][1,5,2]oxazaphosphinine 1-oxide (PubChem CID 2310716) has the molecular formula C21H20ClN4O2P and a molecular weight of 426.84 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-7-methyl-5-phenyl-1-pyrrolidin-1-ylpyrazolo[4,5-c][1,5,2]oxazaphosphinine 1-oxide.
| Compound Name | 3-(4-chlorophenyl)-7-methyl-5-phenyl-1-pyrrolidin-1-ylpyrazolo[4,5-c][1,5,2]oxazaphosphinine 1-oxide |
|---|---|
| PubChem CID | 2310716 |
| Molecular Formula | C21H20ClN4O2P |
| Molecular Weight | 426.84 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 3-(4-chlorophenyl)-7-methyl-5-phenyl-1-pyrrolidin-1-ylpyrazolo[4,5-c][1,5,2]oxazaphosphinine 1-oxide |
| SMILES | Cc1nn(-c2ccccc2)c2c1P(=O)(N1CCCC1)OC(c1ccc(Cl)cc1)=N2 |
| InChI | InChI=1S/C21H20ClN4O2P/c1-15-19-20(26(24-15)18-7-3-2-4-8-18)23-21(16-9-11-17(22)12-10-16)28-29(19,27)25-13-5-6-14-25/h2-4,7-12H,5-6,13-14H2,1H3 |
| InChIKey | TXWOUOJDTNGPIN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.84 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|