About 1,3-dimethyl-6-oxopyrido[1,2-a]quinazoline-4-carbonitrile
1,3-dimethyl-6-oxopyrido[1,2-a]quinazoline-4-carbonitrile (PubChem CID 2310771) has the molecular formula C15H11N3O
and a molecular weight of 249.27 g/mol. Its IUPAC name is 1,3-dimethyl-6-oxopyrido[1,2-a]quinazoline-4-carbonitrile.
Molecular Properties
| Compound Name | 1,3-dimethyl-6-oxopyrido[1,2-a]quinazoline-4-carbonitrile |
| PubChem CID | 2310771 |
| Molecular Formula | C15H11N3O |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 1,3-dimethyl-6-oxopyrido[1,2-a]quinazoline-4-carbonitrile |
| SMILES | Cc1cc(C)n2c(nc(=O)c3ccccc32)c1C#N |
| InChI | InChI=1S/C15H11N3O/c1-9-7-10(2)18-13-6-4-3-5-11(13)15(19)17-14(18)12(9)8-16/h3-7H,1-2H3 |
| InChIKey | BTOXYPVLEVCQLW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 58.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethyl-6-oxopyrido[1,2-a]quinazoline-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-6-oxopyrido[1,2-a]quinazoline-4-carbonitrile?
The IUPAC name of 1,3-dimethyl-6-oxopyrido[1,2-a]quinazoline-4-carbonitrile (CID 2310771) is 1,3-dimethyl-6-oxopyrido[1,2-a]quinazoline-4-carbonitrile.
What is the SMILES notation for 1,3-dimethyl-6-oxopyrido[1,2-a]quinazoline-4-carbonitrile?
The canonical SMILES for 1,3-dimethyl-6-oxopyrido[1,2-a]quinazoline-4-carbonitrile is Cc1cc(C)n2c(nc(=O)c3ccccc32)c1C#N.
What is the InChIKey of 1,3-dimethyl-6-oxopyrido[1,2-a]quinazoline-4-carbonitrile?
The InChIKey is BTOXYPVLEVCQLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3O/c1-9-7-10(2)18-13-6-4-3-5-11(13)15(19)17-14(18)12(9)8-16/h3-7H,1-2H3.
What are the key properties of 1,3-dimethyl-6-oxopyrido[1,2-a]quinazoline-4-carbonitrile?
1,3-dimethyl-6-oxopyrido[1,2-a]quinazoline-4-carbonitrile has a molecular weight of 249.27 g/mol, XLogP of 2.34, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-6-oxopyrido[1,2-a]quinazoline-4-carbonitrile is sourced from PubChem (CID 2310771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).