About diethyl cyclobut-2-ene-1,2-dicarboxylate
diethyl cyclobut-2-ene-1,2-dicarboxylate (PubChem CID 23108344) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is diethyl cyclobut-2-ene-1,2-dicarboxylate.
Molecular Properties
| Compound Name | diethyl cyclobut-2-ene-1,2-dicarboxylate |
| PubChem CID | 23108344 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | diethyl cyclobut-2-ene-1,2-dicarboxylate |
| SMILES | CCOC(=O)C1=CCC1C(=O)OCC |
| InChI | InChI=1S/C10H14O4/c1-3-13-9(11)7-5-6-8(7)10(12)14-4-2/h5,8H,3-4,6H2,1-2H3 |
| InChIKey | YQFQZWAOUKNCPB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze diethyl cyclobut-2-ene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl cyclobut-2-ene-1,2-dicarboxylate?
The IUPAC name of diethyl cyclobut-2-ene-1,2-dicarboxylate (CID 23108344) is diethyl cyclobut-2-ene-1,2-dicarboxylate.
What is the SMILES notation for diethyl cyclobut-2-ene-1,2-dicarboxylate?
The canonical SMILES for diethyl cyclobut-2-ene-1,2-dicarboxylate is CCOC(=O)C1=CCC1C(=O)OCC.
What is the InChIKey of diethyl cyclobut-2-ene-1,2-dicarboxylate?
The InChIKey is YQFQZWAOUKNCPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4/c1-3-13-9(11)7-5-6-8(7)10(12)14-4-2/h5,8H,3-4,6H2,1-2H3.
What are the key properties of diethyl cyclobut-2-ene-1,2-dicarboxylate?
diethyl cyclobut-2-ene-1,2-dicarboxylate has a molecular weight of 198.22 g/mol, XLogP of 1.06, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl cyclobut-2-ene-1,2-dicarboxylate is sourced from PubChem (CID 23108344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).