About cyclobut-2-ene-1,2-dicarbonitrile
cyclobut-2-ene-1,2-dicarbonitrile (PubChem CID 23108350) has the molecular formula C6H4N2
and a molecular weight of 104.11 g/mol. Its IUPAC name is cyclobut-2-ene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | cyclobut-2-ene-1,2-dicarbonitrile |
| PubChem CID | 23108350 |
| Molecular Formula | C6H4N2 |
| Molecular Weight | 104.11 g/mol |
| Exact Mass | 104.04 |
| IUPAC Name | cyclobut-2-ene-1,2-dicarbonitrile |
| SMILES | N#CC1=CCC1C#N |
| InChI | InChI=1S/C6H4N2/c7-3-5-1-2-6(5)4-8/h1,6H,2H2 |
| InChIKey | LWKVKUNGXZJKRY-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.11 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclobut-2-ene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobut-2-ene-1,2-dicarbonitrile?
The IUPAC name of cyclobut-2-ene-1,2-dicarbonitrile (CID 23108350) is cyclobut-2-ene-1,2-dicarbonitrile.
What is the SMILES notation for cyclobut-2-ene-1,2-dicarbonitrile?
The canonical SMILES for cyclobut-2-ene-1,2-dicarbonitrile is N#CC1=CCC1C#N.
What is the InChIKey of cyclobut-2-ene-1,2-dicarbonitrile?
The InChIKey is LWKVKUNGXZJKRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2/c7-3-5-1-2-6(5)4-8/h1,6H,2H2.
What are the key properties of cyclobut-2-ene-1,2-dicarbonitrile?
cyclobut-2-ene-1,2-dicarbonitrile has a molecular weight of 104.11 g/mol, XLogP of 0.98, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobut-2-ene-1,2-dicarbonitrile is sourced from PubChem (CID 23108350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).