C29H34ClN3O3 — CID 23108891
3-chloro-N-[[4-[4-[(3,4-dimethoxyphenyl)methyl]-1,4-diazepan-1-yl]phenyl]methyl]-2-methylbenzamide (PubChem CID 23108891) has the molecular formula C29H34ClN3O3 and a molecular weight of 508.06 g/mol. Its IUPAC name is 3-chloro-N-[[4-[4-[(3,4-dimethoxyphenyl)methyl]-1,4-diazepan-1-yl]phenyl]methyl]-2-methylbenzamide.
| Compound Name | 3-chloro-N-[[4-[4-[(3,4-dimethoxyphenyl)methyl]-1,4-diazepan-1-yl]phenyl]methyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 23108891 |
| Molecular Formula | C29H34ClN3O3 |
| Molecular Weight | 508.06 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | 3-chloro-N-[[4-[4-[(3,4-dimethoxyphenyl)methyl]-1,4-diazepan-1-yl]phenyl]methyl]-2-methylbenzamide |
| SMILES | COc1ccc(CN2CCCN(c3ccc(CNC(=O)c4cccc(Cl)c4C)cc3)CC2)cc1OC |
| InChI | InChI=1S/C29H34ClN3O3/c1-21-25(6-4-7-26(21)30)29(34)31-19-22-8-11-24(12-9-22)33-15-5-14-32(16-17-33)20-23-10-13-27(35-2)28(18-23)36-3/h4,6-13,18H,5,14-17,19-20H2,1-3H3,(H,31,34) |
| InChIKey | PHCNBTQZMMCAMT-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.06 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|