About 2-methyl-N-propan-2-ylhexa-1,5-dien-3-amine
2-methyl-N-propan-2-ylhexa-1,5-dien-3-amine (PubChem CID 23109100) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is 2-methyl-N-propan-2-ylhexa-1,5-dien-3-amine.
Molecular Properties
| Compound Name | 2-methyl-N-propan-2-ylhexa-1,5-dien-3-amine |
| PubChem CID | 23109100 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | 2-methyl-N-propan-2-ylhexa-1,5-dien-3-amine |
| SMILES | C=CCC(NC(C)C)C(=C)C |
| InChI | InChI=1S/C10H19N/c1-6-7-10(8(2)3)11-9(4)5/h6,9-11H,1-2,7H2,3-5H3 |
| InChIKey | GRLMRXKBEURAKV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-propan-2-ylhexa-1,5-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-propan-2-ylhexa-1,5-dien-3-amine?
The IUPAC name of 2-methyl-N-propan-2-ylhexa-1,5-dien-3-amine (CID 23109100) is 2-methyl-N-propan-2-ylhexa-1,5-dien-3-amine.
What is the SMILES notation for 2-methyl-N-propan-2-ylhexa-1,5-dien-3-amine?
The canonical SMILES for 2-methyl-N-propan-2-ylhexa-1,5-dien-3-amine is C=CCC(NC(C)C)C(=C)C.
What is the InChIKey of 2-methyl-N-propan-2-ylhexa-1,5-dien-3-amine?
The InChIKey is GRLMRXKBEURAKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N/c1-6-7-10(8(2)3)11-9(4)5/h6,9-11H,1-2,7H2,3-5H3.
What are the key properties of 2-methyl-N-propan-2-ylhexa-1,5-dien-3-amine?
2-methyl-N-propan-2-ylhexa-1,5-dien-3-amine has a molecular weight of 153.27 g/mol, XLogP of 2.51, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-propan-2-ylhexa-1,5-dien-3-amine is sourced from PubChem (CID 23109100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).