About 2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine
2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine (PubChem CID 23109108) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is 2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine.
Molecular Properties
| Compound Name | 2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine |
| PubChem CID | 23109108 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine |
| SMILES | C=CCNC(CC(=C)C)CC(=C)C |
| InChI | InChI=1S/C12H21N/c1-6-7-13-12(8-10(2)3)9-11(4)5/h6,12-13H,1-2,4,7-9H2,3,5H3 |
| InChIKey | QGQIKFHTFJFJQS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine?
The IUPAC name of 2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine (CID 23109108) is 2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine.
What is the SMILES notation for 2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine?
The canonical SMILES for 2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine is C=CCNC(CC(=C)C)CC(=C)C.
What is the InChIKey of 2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine?
The InChIKey is QGQIKFHTFJFJQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N/c1-6-7-13-12(8-10(2)3)9-11(4)5/h6,12-13H,1-2,4,7-9H2,3,5H3.
What are the key properties of 2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine?
2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine has a molecular weight of 179.31 g/mol, XLogP of 3.06, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-N-prop-2-enylhepta-1,6-dien-4-amine is sourced from PubChem (CID 23109108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).