C18H20O3 — CID 23109182
[2-(2,5-dihydroxypentyl)phenyl]-phenylmethanone (PubChem CID 23109182) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is [2-(2,5-dihydroxypentyl)phenyl]-phenylmethanone.
| Compound Name | [2-(2,5-dihydroxypentyl)phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 23109182 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | [2-(2,5-dihydroxypentyl)phenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccccc1CC(O)CCCO |
| InChI | InChI=1S/C18H20O3/c19-12-6-10-16(20)13-15-9-4-5-11-17(15)18(21)14-7-2-1-3-8-14/h1-5,7-9,11,16,19-20H,6,10,12-13H2 |
| InChIKey | MIIJNJRJVXSBNH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |