C27H44ClN3O2 — CID 23109302
1-butyl-3-(2-methylpropyl)-8-(6-phenylhexyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride (PubChem CID 23109302) has the molecular formula C27H44ClN3O2 and a molecular weight of 478.12 g/mol. Its IUPAC name is 1-butyl-3-(2-methylpropyl)-8-(6-phenylhexyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride.
| Compound Name | 1-butyl-3-(2-methylpropyl)-8-(6-phenylhexyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 23109302 |
| Molecular Formula | C27H44ClN3O2 |
| Molecular Weight | 478.12 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | 1-butyl-3-(2-methylpropyl)-8-(6-phenylhexyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride |
| SMILES | CCCCN1C(=O)N(CC(C)C)C(=O)C12CCN(CCCCCCc1ccccc1)CC2.Cl |
| InChI | InChI=1S/C27H43N3O2.ClH/c1-4-5-19-30-26(32)29(22-23(2)3)25(31)27(30)16-20-28(21-17-27)18-12-7-6-9-13-24-14-10-8-11-15-24;/h8,10-11,14-15,23H,4-7,9,12-13,16-22H2,1-3H3;1H |
| InChIKey | FWBHCIGLSFEKQE-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.12 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|