C25H39N3O — CID 23109367
9-benzyl-1-butyl-3-cyclohexyl-1,3,9-triazaspiro[5.5]undecan-2-one (PubChem CID 23109367) has the molecular formula C25H39N3O and a molecular weight of 397.61 g/mol. Its IUPAC name is 9-benzyl-1-butyl-3-cyclohexyl-1,3,9-triazaspiro[5.5]undecan-2-one.
| Compound Name | 9-benzyl-1-butyl-3-cyclohexyl-1,3,9-triazaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 23109367 |
| Molecular Formula | C25H39N3O |
| Molecular Weight | 397.61 g/mol |
| Exact Mass | 397.31 |
| IUPAC Name | 9-benzyl-1-butyl-3-cyclohexyl-1,3,9-triazaspiro[5.5]undecan-2-one |
| SMILES | CCCCN1C(=O)N(C2CCCCC2)CCC12CCN(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C25H39N3O/c1-2-3-17-28-24(29)27(23-12-8-5-9-13-23)20-16-25(28)14-18-26(19-15-25)21-22-10-6-4-7-11-22/h4,6-7,10-11,23H,2-3,5,8-9,12-21H2,1H3 |
| InChIKey | BRJTUXJCVAZKJV-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.61 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |