About 1-butyl-1,2,8-triazaspiro[4.5]decan-3-one;dihydrochloride
1-butyl-1,2,8-triazaspiro[4.5]decan-3-one;dihydrochloride (PubChem CID 23109434) has the molecular formula C11H23Cl2N3O
and a molecular weight of 284.23 g/mol. Its IUPAC name is 1-butyl-1,2,8-triazaspiro[4.5]decan-3-one;dihydrochloride.
Molecular Properties
| Compound Name | 1-butyl-1,2,8-triazaspiro[4.5]decan-3-one;dihydrochloride |
| PubChem CID | 23109434 |
| Molecular Formula | C11H23Cl2N3O |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 1-butyl-1,2,8-triazaspiro[4.5]decan-3-one;dihydrochloride |
| SMILES | CCCCN1NC(=O)CC12CCNCC2.Cl.Cl |
| InChI | InChI=1S/C11H21N3O.2ClH/c1-2-3-8-14-11(9-10(15)13-14)4-6-12-7-5-11;;/h12H,2-9H2,1H3,(H,13,15);2*1H |
| InChIKey | PRMJYGPCJMKKJU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butyl-1,2,8-triazaspiro[4.5]decan-3-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-1,2,8-triazaspiro[4.5]decan-3-one;dihydrochloride?
The IUPAC name of 1-butyl-1,2,8-triazaspiro[4.5]decan-3-one;dihydrochloride (CID 23109434) is 1-butyl-1,2,8-triazaspiro[4.5]decan-3-one;dihydrochloride.
What is the SMILES notation for 1-butyl-1,2,8-triazaspiro[4.5]decan-3-one;dihydrochloride?
The canonical SMILES for 1-butyl-1,2,8-triazaspiro[4.5]decan-3-one;dihydrochloride is CCCCN1NC(=O)CC12CCNCC2.Cl.Cl.
What is the InChIKey of 1-butyl-1,2,8-triazaspiro[4.5]decan-3-one;dihydrochloride?
The InChIKey is PRMJYGPCJMKKJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O.2ClH/c1-2-3-8-14-11(9-10(15)13-14)4-6-12-7-5-11;;/h12H,2-9H2,1H3,(H,13,15);2*1H.
What are the key properties of 1-butyl-1,2,8-triazaspiro[4.5]decan-3-one;dihydrochloride?
1-butyl-1,2,8-triazaspiro[4.5]decan-3-one;dihydrochloride has a molecular weight of 284.23 g/mol, XLogP of 1.49, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-1,2,8-triazaspiro[4.5]decan-3-one;dihydrochloride is sourced from PubChem (CID 23109434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).