About 1-butyl-1,2,8-triazaspiro[4.5]decan-3-one
1-butyl-1,2,8-triazaspiro[4.5]decan-3-one (PubChem CID 23109435) has the molecular formula C11H21N3O
and a molecular weight of 211.31 g/mol. Its IUPAC name is 1-butyl-1,2,8-triazaspiro[4.5]decan-3-one.
Molecular Properties
| Compound Name | 1-butyl-1,2,8-triazaspiro[4.5]decan-3-one |
| PubChem CID | 23109435 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 1-butyl-1,2,8-triazaspiro[4.5]decan-3-one |
| SMILES | CCCCN1NC(=O)CC12CCNCC2 |
| InChI | InChI=1S/C11H21N3O/c1-2-3-8-14-11(9-10(15)13-14)4-6-12-7-5-11/h12H,2-9H2,1H3,(H,13,15) |
| InChIKey | CBSVJWRXYPGGFM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butyl-1,2,8-triazaspiro[4.5]decan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-1,2,8-triazaspiro[4.5]decan-3-one?
The IUPAC name of 1-butyl-1,2,8-triazaspiro[4.5]decan-3-one (CID 23109435) is 1-butyl-1,2,8-triazaspiro[4.5]decan-3-one.
What is the SMILES notation for 1-butyl-1,2,8-triazaspiro[4.5]decan-3-one?
The canonical SMILES for 1-butyl-1,2,8-triazaspiro[4.5]decan-3-one is CCCCN1NC(=O)CC12CCNCC2.
What is the InChIKey of 1-butyl-1,2,8-triazaspiro[4.5]decan-3-one?
The InChIKey is CBSVJWRXYPGGFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O/c1-2-3-8-14-11(9-10(15)13-14)4-6-12-7-5-11/h12H,2-9H2,1H3,(H,13,15).
What are the key properties of 1-butyl-1,2,8-triazaspiro[4.5]decan-3-one?
1-butyl-1,2,8-triazaspiro[4.5]decan-3-one has a molecular weight of 211.31 g/mol, XLogP of 0.65, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-1,2,8-triazaspiro[4.5]decan-3-one is sourced from PubChem (CID 23109435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).