About 4H-indazole
4H-indazole (PubChem CID 23109654) has the molecular formula C7H6N2
and a molecular weight of 118.14 g/mol. Its IUPAC name is 4H-indazole.
Molecular Properties
| Compound Name | 4H-indazole |
| PubChem CID | 23109654 |
| Molecular Formula | C7H6N2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.05 |
| IUPAC Name | 4H-indazole |
| SMILES | C1=CCC2=CN=NC2=C1 |
| InChI | InChI=1S/C7H6N2/c1-2-4-7-6(3-1)5-8-9-7/h1-2,4-5H,3H2 |
| InChIKey | NOMWSIXEERHDSY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-indazole?
The IUPAC name of 4H-indazole (CID 23109654) is 4H-indazole.
What is the SMILES notation for 4H-indazole?
The canonical SMILES for 4H-indazole is C1=CCC2=CN=NC2=C1.
What is the InChIKey of 4H-indazole?
The InChIKey is NOMWSIXEERHDSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2/c1-2-4-7-6(3-1)5-8-9-7/h1-2,4-5H,3H2.
What are the key properties of 4H-indazole?
4H-indazole has a molecular weight of 118.14 g/mol, XLogP of 2.18, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-indazole is sourced from PubChem (CID 23109654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).