C24H30N8O6S — CID 23109861
2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 23109861) has the molecular formula C24H30N8O6S and a molecular weight of 558.62 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 23109861 |
| Molecular Formula | C24H30N8O6S |
| Molecular Weight | 558.62 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | NC(CS)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C24H30N8O6S/c25-17(10-39)21(34)30-18(5-13-1-3-16(33)4-2-13)22(35)31-19(6-14-8-26-11-28-14)23(36)32-20(24(37)38)7-15-9-27-12-29-15/h1-4,8-9,11-12,17-20,33,39H,5-7,10,25H2,(H,26,28)(H,27,29)(H,30,34)(H,31,35)(H,32,36)(H,37,38) |
| InChIKey | ADIXEDDPSAXGRO-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 228.21 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.62 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|