C15H21N2O2- — CID 23109910
4-(2,4,6-trimethylanilino)piperidine-1-carboxylate (PubChem CID 23109910) has the molecular formula C15H21N2O2- and a molecular weight of 261.34 g/mol. Its IUPAC name is 4-(2,4,6-trimethylanilino)piperidine-1-carboxylate.
| Compound Name | 4-(2,4,6-trimethylanilino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 23109910 |
| Molecular Formula | C15H21N2O2- |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 4-(2,4,6-trimethylanilino)piperidine-1-carboxylate |
| SMILES | Cc1cc(C)c(NC2CCN(C(=O)[O-])CC2)c(C)c1 |
| InChI | InChI=1S/C15H22N2O2/c1-10-8-11(2)14(12(3)9-10)16-13-4-6-17(7-5-13)15(18)19/h8-9,13,16H,4-7H2,1-3H3,(H,18,19)/p-1 |
| InChIKey | SYGKBVKZXVKSFF-UHFFFAOYSA-M |
| XLogP | 1.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |