C32H25N4O12P — CID 23110737
10,16-bis(3,5-dinitrophenyl)-13-hydroxy-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2,8,10,15,17-hexaene 13-oxide (PubChem CID 23110737) has the molecular formula C32H25N4O12P and a molecular weight of 688.54 g/mol. Its IUPAC name is 10,16-bis(3,5-dinitrophenyl)-13-hydroxy-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2,8,10,15,17-hexaene 13-oxide.
| Compound Name | 10,16-bis(3,5-dinitrophenyl)-13-hydroxy-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2,8,10,15,17-hexaene 13-oxide |
|---|---|
| PubChem CID | 23110737 |
| Molecular Formula | C32H25N4O12P |
| Molecular Weight | 688.54 g/mol |
| Exact Mass | 688.12 |
| IUPAC Name | 10,16-bis(3,5-dinitrophenyl)-13-hydroxy-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2,8,10,15,17-hexaene 13-oxide |
| SMILES | O=[N+]([O-])c1cc(-c2cc3c(c4c2OP(=O)(O)Oc2c(-c5cc([N+](=O)[O-])cc([N+](=O)[O-])c5)cc5c(c2-4)CCCC5)CCCC3)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C32H25N4O12P/c37-33(38)21-9-19(10-22(15-21)34(39)40)27-13-17-5-1-3-7-25(17)29-30-26-8-4-2-6-18(26)14-28(32(30)48-49(45,46)47-31(27)29)20-11-23(35(41)42)16-24(12-20)36(43)44/h9-16H,1-8H2,(H,45,46) |
| InChIKey | NTKZYRJEGHTGDH-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 228.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.54 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|