About 9H-fluorene-3,6-diamine
9H-fluorene-3,6-diamine (PubChem CID 23110770) has the molecular formula C13H12N2
and a molecular weight of 196.25 g/mol. Its IUPAC name is 9H-fluorene-3,6-diamine.
Molecular Properties
| Compound Name | 9H-fluorene-3,6-diamine |
| PubChem CID | 23110770 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 9H-fluorene-3,6-diamine |
| SMILES | Nc1ccc2c(c1)-c1cc(N)ccc1C2 |
| InChI | InChI=1S/C13H12N2/c14-10-3-1-8-5-9-2-4-11(15)7-13(9)12(8)6-10/h1-4,6-7H,5,14-15H2 |
| InChIKey | RTFUEWUXBUEAEA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluorene-3,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluorene-3,6-diamine?
The IUPAC name of 9H-fluorene-3,6-diamine (CID 23110770) is 9H-fluorene-3,6-diamine.
What is the SMILES notation for 9H-fluorene-3,6-diamine?
The canonical SMILES for 9H-fluorene-3,6-diamine is Nc1ccc2c(c1)-c1cc(N)ccc1C2.
What is the InChIKey of 9H-fluorene-3,6-diamine?
The InChIKey is RTFUEWUXBUEAEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2/c14-10-3-1-8-5-9-2-4-11(15)7-13(9)12(8)6-10/h1-4,6-7H,5,14-15H2.
What are the key properties of 9H-fluorene-3,6-diamine?
9H-fluorene-3,6-diamine has a molecular weight of 196.25 g/mol, XLogP of 2.42, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluorene-3,6-diamine is sourced from PubChem (CID 23110770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).