C16H15BrN5O2+ — CID 2311079
4-[(4R)-2-amino-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-4-yl]-2-bromo-6-methoxyphenol (PubChem CID 2311079) has the molecular formula C16H15BrN5O2+ and a molecular weight of 389.23 g/mol. Its IUPAC name is 4-[(4R)-2-amino-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-4-yl]-2-bromo-6-methoxyphenol.
| Compound Name | 4-[(4R)-2-amino-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-4-yl]-2-bromo-6-methoxyphenol |
|---|---|
| PubChem CID | 2311079 |
| Molecular Formula | C16H15BrN5O2+ |
| Molecular Weight | 389.23 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 4-[(4R)-2-amino-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-4-yl]-2-bromo-6-methoxyphenol |
| SMILES | COc1cc([C@@H]2N=C(N)Nc3[nH]c4ccccc4[n+]32)cc(Br)c1O |
| InChI | InChI=1S/C16H14BrN5O2/c1-24-12-7-8(6-9(17)13(12)23)14-20-15(18)21-16-19-10-4-2-3-5-11(10)22(14)16/h2-7,14H,1H3,(H4,18,19,20,21,23)/p+1/t14-/m1/s1 |
| InChIKey | USVSWUXCYNROOJ-CQSZACIVSA-O |
| XLogP | 2.22 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|