C16H30O2 — CID 23110806
3,6-diethyl-2,2,7,7-tetramethyloct-4-yne-3,6-diol (PubChem CID 23110806) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is 3,6-diethyl-2,2,7,7-tetramethyloct-4-yne-3,6-diol.
| Compound Name | 3,6-diethyl-2,2,7,7-tetramethyloct-4-yne-3,6-diol |
|---|---|
| PubChem CID | 23110806 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 3,6-diethyl-2,2,7,7-tetramethyloct-4-yne-3,6-diol |
| SMILES | CCC(O)(C#CC(O)(CC)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H30O2/c1-9-15(17,13(3,4)5)11-12-16(18,10-2)14(6,7)8/h17-18H,9-10H2,1-8H3 |
| InChIKey | RALKTXRCGSJMOD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|