About 2-(4-bromophenyl)-3-(4-methoxyphenyl)-4,5-dihydroimidazo[1,2-a]quinolin-10-ium
2-(4-bromophenyl)-3-(4-methoxyphenyl)-4,5-dihydroimidazo[1,2-a]quinolin-10-ium (PubChem CID 2311083) has the molecular formula C24H20BrN2O+
and a molecular weight of 432.34 g/mol. Its IUPAC name is 2-(4-bromophenyl)-3-(4-methoxyphenyl)-4,5-dihydroimidazo[1,2-a]quinolin-10-ium.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-3-(4-methoxyphenyl)-4,5-dihydroimidazo[1,2-a]quinolin-10-ium |
| PubChem CID | 2311083 |
| Molecular Formula | C24H20BrN2O+ |
| Molecular Weight | 432.34 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 2-(4-bromophenyl)-3-(4-methoxyphenyl)-4,5-dihydroimidazo[1,2-a]quinolin-10-ium |
| SMILES | COc1ccc(-n2c(-c3ccc(Br)cc3)c[n+]3c2CCc2ccccc2-3)cc1 |
| InChI | InChI=1S/C24H20BrN2O/c1-28-21-13-11-20(12-14-21)27-23(18-6-9-19(25)10-7-18)16-26-22-5-3-2-4-17(22)8-15-24(26)27/h2-7,9-14,16H,8,15H2,1H3/q+1 |
| InChIKey | KMZJWZKHQPPHCT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.34 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromophenyl)-3-(4-methoxyphenyl)-4,5-dihydroimidazo[1,2-a]quinolin-10-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-3-(4-methoxyphenyl)-4,5-dihydroimidazo[1,2-a]quinolin-10-ium?
The IUPAC name of 2-(4-bromophenyl)-3-(4-methoxyphenyl)-4,5-dihydroimidazo[1,2-a]quinolin-10-ium (CID 2311083) is 2-(4-bromophenyl)-3-(4-methoxyphenyl)-4,5-dihydroimidazo[1,2-a]quinolin-10-ium.
What is the SMILES notation for 2-(4-bromophenyl)-3-(4-methoxyphenyl)-4,5-dihydroimidazo[1,2-a]quinolin-10-ium?
The canonical SMILES for 2-(4-bromophenyl)-3-(4-methoxyphenyl)-4,5-dihydroimidazo[1,2-a]quinolin-10-ium is COc1ccc(-n2c(-c3ccc(Br)cc3)c[n+]3c2CCc2ccccc2-3)cc1.
What is the InChIKey of 2-(4-bromophenyl)-3-(4-methoxyphenyl)-4,5-dihydroimidazo[1,2-a]quinolin-10-ium?
The InChIKey is KMZJWZKHQPPHCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20BrN2O/c1-28-21-13-11-20(12-14-21)27-23(18-6-9-19(25)10-7-18)16-26-22-5-3-2-4-17(22)8-15-24(26)27/h2-7,9-14,16H,8,15H2,1H3/q+1.
What are the key properties of 2-(4-bromophenyl)-3-(4-methoxyphenyl)-4,5-dihydroimidazo[1,2-a]quinolin-10-ium?
2-(4-bromophenyl)-3-(4-methoxyphenyl)-4,5-dihydroimidazo[1,2-a]quinolin-10-ium has a molecular weight of 432.34 g/mol, XLogP of 5.29, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-3-(4-methoxyphenyl)-4,5-dihydroimidazo[1,2-a]quinolin-10-ium is sourced from PubChem (CID 2311083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).