About dipotassium;6-oxo-5,5-diphenylpyrimidine-2,4-diolate
dipotassium;6-oxo-5,5-diphenylpyrimidine-2,4-diolate (PubChem CID 23110848) has the molecular formula C16H10K2N2O3
and a molecular weight of 356.46 g/mol. Its IUPAC name is dipotassium;6-oxo-5,5-diphenylpyrimidine-2,4-diolate.
Molecular Properties
| Compound Name | dipotassium;6-oxo-5,5-diphenylpyrimidine-2,4-diolate |
| PubChem CID | 23110848 |
| Molecular Formula | C16H10K2N2O3 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | dipotassium;6-oxo-5,5-diphenylpyrimidine-2,4-diolate |
| SMILES | O=C1N=C([O-])N=C([O-])C1(c1ccccc1)c1ccccc1.[K+].[K+] |
| InChI | InChI=1S/C16H12N2O3.2K/c19-13-16(11-7-3-1-4-8-11,12-9-5-2-6-10-12)14(20)18-15(21)17-13;;/h1-10H,(H2,17,18,19,20,21);;/q;2*+1/p-2 |
| InChIKey | FMNPRMIVAINURK-UHFFFAOYSA-L |
| XLogP | -6.00 |
| TPSA | 87.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | -6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze dipotassium;6-oxo-5,5-diphenylpyrimidine-2,4-diolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;6-oxo-5,5-diphenylpyrimidine-2,4-diolate?
The IUPAC name of dipotassium;6-oxo-5,5-diphenylpyrimidine-2,4-diolate (CID 23110848) is dipotassium;6-oxo-5,5-diphenylpyrimidine-2,4-diolate.
What is the SMILES notation for dipotassium;6-oxo-5,5-diphenylpyrimidine-2,4-diolate?
The canonical SMILES for dipotassium;6-oxo-5,5-diphenylpyrimidine-2,4-diolate is O=C1N=C([O-])N=C([O-])C1(c1ccccc1)c1ccccc1.[K+].[K+].
What is the InChIKey of dipotassium;6-oxo-5,5-diphenylpyrimidine-2,4-diolate?
The InChIKey is FMNPRMIVAINURK-UHFFFAOYSA-L. The full InChI is InChI=1S/C16H12N2O3.2K/c19-13-16(11-7-3-1-4-8-11,12-9-5-2-6-10-12)14(20)18-15(21)17-13;;/h1-10H,(H2,17,18,19,20,21);;/q;2*+1/p-2.
What are the key properties of dipotassium;6-oxo-5,5-diphenylpyrimidine-2,4-diolate?
dipotassium;6-oxo-5,5-diphenylpyrimidine-2,4-diolate has a molecular weight of 356.46 g/mol, XLogP of -6.00, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;6-oxo-5,5-diphenylpyrimidine-2,4-diolate is sourced from PubChem (CID 23110848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).